C14H19NO4S2 — CID 107767270
3-[2-(3-methylbutylsulfonyl)ethylsulfonyl]benzonitrile (PubChem CID 107767270) has the molecular formula C14H19NO4S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 3-[2-(3-methylbutylsulfonyl)ethylsulfonyl]benzonitrile.
| Compound Name | 3-[2-(3-methylbutylsulfonyl)ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 107767270 |
| Molecular Formula | C14H19NO4S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-[2-(3-methylbutylsulfonyl)ethylsulfonyl]benzonitrile |
| SMILES | CC(C)CCS(=O)(=O)CCS(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C14H19NO4S2/c1-12(2)6-7-20(16,17)8-9-21(18,19)14-5-3-4-13(10-14)11-15/h3-5,10,12H,6-9H2,1-2H3 |
| InChIKey | ZPBKYODNIUJNMC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 92.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |