C11H11F2NO3S — CID 82004974
3-[2-(2,2-difluoroethoxy)ethylsulfonyl]benzonitrile (PubChem CID 82004974) has the molecular formula C11H11F2NO3S and a molecular weight of 275.28 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethylsulfonyl]benzonitrile.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 82004974 |
| Molecular Formula | C11H11F2NO3S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethylsulfonyl]benzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)CCOCC(F)F)c1 |
| InChI | InChI=1S/C11H11F2NO3S/c12-11(13)8-17-4-5-18(15,16)10-3-1-2-9(6-10)7-14/h1-3,6,11H,4-5,8H2 |
| InChIKey | XYXODJOJJNZDFH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|