C11H11F3N2O3S — CID 82722744
3-[2-(2,2,2-trifluoroethoxyamino)ethylsulfonyl]benzonitrile (PubChem CID 82722744) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is 3-[2-(2,2,2-trifluoroethoxyamino)ethylsulfonyl]benzonitrile.
| Compound Name | 3-[2-(2,2,2-trifluoroethoxyamino)ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 82722744 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-[2-(2,2,2-trifluoroethoxyamino)ethylsulfonyl]benzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)CCNOCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N2O3S/c12-11(13,14)8-19-16-4-5-20(17,18)10-3-1-2-9(6-10)7-15/h1-3,6,16H,4-5,8H2 |
| InChIKey | NMIRBDIRMXVCAZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|