C14H20N2O3S — CID 115764558
3-[2-[(1-methoxy-2-methylpropan-2-yl)amino]ethylsulfonyl]benzonitrile (PubChem CID 115764558) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 3-[2-[(1-methoxy-2-methylpropan-2-yl)amino]ethylsulfonyl]benzonitrile.
| Compound Name | 3-[2-[(1-methoxy-2-methylpropan-2-yl)amino]ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 115764558 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-[2-[(1-methoxy-2-methylpropan-2-yl)amino]ethylsulfonyl]benzonitrile |
| SMILES | COCC(C)(C)NCCS(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C14H20N2O3S/c1-14(2,11-19-3)16-7-8-20(17,18)13-6-4-5-12(9-13)10-15/h4-6,9,16H,7-8,11H2,1-3H3 |
| InChIKey | IFFQYGWRCYUBBA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |