C10H11N2S- — CID 91928127
1-cyclopenta-1,4-dien-1-yl-N-(1,3-thiazol-2-ylmethyl)methanamine (PubChem CID 91928127) has the molecular formula C10H11N2S- and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-cyclopenta-1,4-dien-1-yl-N-(1,3-thiazol-2-ylmethyl)methanamine.
| Compound Name | 1-cyclopenta-1,4-dien-1-yl-N-(1,3-thiazol-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 91928127 |
| Molecular Formula | C10H11N2S- |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 1-cyclopenta-1,4-dien-1-yl-N-(1,3-thiazol-2-ylmethyl)methanamine |
| SMILES | c1cc(CNCc2nccs2)c[cH-]1 |
| InChI | InChI=1S/C10H11N2S/c1-2-4-9(3-1)7-11-8-10-12-5-6-13-10/h1-6,11H,7-8H2/q-1 |
| InChIKey | BTJPURRBVFQTAS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|