C11H14N3- — CID 91928163
1-cyclopenta-1,4-dien-1-yl-N-[(1-methylimidazol-2-yl)methyl]methanamine (PubChem CID 91928163) has the molecular formula C11H14N3- and a molecular weight of 188.25 g/mol. Its IUPAC name is 1-cyclopenta-1,4-dien-1-yl-N-[(1-methylimidazol-2-yl)methyl]methanamine.
| Compound Name | 1-cyclopenta-1,4-dien-1-yl-N-[(1-methylimidazol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 91928163 |
| Molecular Formula | C11H14N3- |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-cyclopenta-1,4-dien-1-yl-N-[(1-methylimidazol-2-yl)methyl]methanamine |
| SMILES | Cn1ccnc1CNCc1cc[cH-]c1 |
| InChI | InChI=1S/C11H14N3/c1-14-7-6-13-11(14)9-12-8-10-4-2-3-5-10/h2-7,12H,8-9H2,1H3/q-1 |
| InChIKey | SWWVKRSIWHZOFV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|