C9H14N6 — CID 115682578
N-[(1-methylimidazol-2-yl)methyl]-1-(3-methyltriazol-4-yl)methanamine (PubChem CID 115682578) has the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. Its IUPAC name is N-[(1-methylimidazol-2-yl)methyl]-1-(3-methyltriazol-4-yl)methanamine.
| Compound Name | N-[(1-methylimidazol-2-yl)methyl]-1-(3-methyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 115682578 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | N-[(1-methylimidazol-2-yl)methyl]-1-(3-methyltriazol-4-yl)methanamine |
| SMILES | Cn1ccnc1CNCc1cnnn1C |
| InChI | InChI=1S/C9H14N6/c1-14-4-3-11-9(14)7-10-5-8-6-12-13-15(8)2/h3-4,6,10H,5,7H2,1-2H3 |
| InChIKey | KBRPWBFKTDQJFX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |