C11H14N4 — CID 115682087
N-[(3-methyltriazol-4-yl)methyl]-1-phenylmethanamine (PubChem CID 115682087) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is N-[(3-methyltriazol-4-yl)methyl]-1-phenylmethanamine.
| Compound Name | N-[(3-methyltriazol-4-yl)methyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 115682087 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | N-[(3-methyltriazol-4-yl)methyl]-1-phenylmethanamine |
| SMILES | Cn1nncc1CNCc1ccccc1 |
| InChI | InChI=1S/C11H14N4/c1-15-11(9-13-14-15)8-12-7-10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3 |
| InChIKey | JHQYCVJPKXYBPB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |