C12H16N4O — CID 113257729
(2R)-2-[(3-methyltriazol-4-yl)methylamino]-2-phenylethanol (PubChem CID 113257729) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is (2R)-2-[(3-methyltriazol-4-yl)methylamino]-2-phenylethanol.
| Compound Name | (2R)-2-[(3-methyltriazol-4-yl)methylamino]-2-phenylethanol |
|---|---|
| PubChem CID | 113257729 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2R)-2-[(3-methyltriazol-4-yl)methylamino]-2-phenylethanol |
| SMILES | Cn1nncc1CN[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C12H16N4O/c1-16-11(8-14-15-16)7-13-12(9-17)10-5-3-2-4-6-10/h2-6,8,12-13,17H,7,9H2,1H3/t12-/m0/s1 |
| InChIKey | STTDTBFFXQTTFJ-LBPRGKRZSA-N |
| XLogP | 0.64 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |