C12H18N4S — CID 115682482
N-[(3-methyltriazol-4-yl)methyl]-1-thiophen-2-ylbutan-1-amine (PubChem CID 115682482) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is N-[(3-methyltriazol-4-yl)methyl]-1-thiophen-2-ylbutan-1-amine.
| Compound Name | N-[(3-methyltriazol-4-yl)methyl]-1-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 115682482 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-[(3-methyltriazol-4-yl)methyl]-1-thiophen-2-ylbutan-1-amine |
| SMILES | CCCC(NCc1cnnn1C)c1cccs1 |
| InChI | InChI=1S/C12H18N4S/c1-3-5-11(12-6-4-7-17-12)13-8-10-9-14-15-16(10)2/h4,6-7,9,11,13H,3,5,8H2,1-2H3 |
| InChIKey | OHDOLCXPKUTFBJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |