C14H21N3OS — CID 64830398
2-[4-[(1-thiophen-2-ylbutylamino)methyl]pyrazol-1-yl]ethanol (PubChem CID 64830398) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-[4-[(1-thiophen-2-ylbutylamino)methyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[(1-thiophen-2-ylbutylamino)methyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 64830398 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-[4-[(1-thiophen-2-ylbutylamino)methyl]pyrazol-1-yl]ethanol |
| SMILES | CCCC(NCc1cnn(CCO)c1)c1cccs1 |
| InChI | InChI=1S/C14H21N3OS/c1-2-4-13(14-5-3-8-19-14)15-9-12-10-16-17(11-12)6-7-18/h3,5,8,10-11,13,15,18H,2,4,6-7,9H2,1H3 |
| InChIKey | PQKYPESFKGFVTG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |