C15H22N2S — CID 66413550
N-[(1-propylpyrrol-2-yl)methyl]-1-thiophen-2-ylpropan-1-amine (PubChem CID 66413550) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N-[(1-propylpyrrol-2-yl)methyl]-1-thiophen-2-ylpropan-1-amine.
| Compound Name | N-[(1-propylpyrrol-2-yl)methyl]-1-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 66413550 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[(1-propylpyrrol-2-yl)methyl]-1-thiophen-2-ylpropan-1-amine |
| SMILES | CCCn1cccc1CNC(CC)c1cccs1 |
| InChI | InChI=1S/C15H22N2S/c1-3-9-17-10-5-7-13(17)12-16-14(4-2)15-8-6-11-18-15/h5-8,10-11,14,16H,3-4,9,12H2,1-2H3 |
| InChIKey | RPBSOQLLQQSLQW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |