C7H15Cl2N3O — CID 47000713
2-[(1-methylimidazol-2-yl)methylamino]ethanol;dihydrochloride (PubChem CID 47000713) has the molecular formula C7H15Cl2N3O and a molecular weight of 228.12 g/mol. Its IUPAC name is 2-[(1-methylimidazol-2-yl)methylamino]ethanol;dihydrochloride.
| Compound Name | 2-[(1-methylimidazol-2-yl)methylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 47000713 |
| Molecular Formula | C7H15Cl2N3O |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2-[(1-methylimidazol-2-yl)methylamino]ethanol;dihydrochloride |
| SMILES | Cl.Cl.Cn1ccnc1CNCCO |
| InChI | InChI=1S/C7H13N3O.2ClH/c1-10-4-2-9-7(10)6-8-3-5-11;;/h2,4,8,11H,3,5-6H2,1H3;2*1H |
| InChIKey | LHYDJNXGXAOOMQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|