C10H19ClN4O2 — CID 115616317
ethyl N-[2-[(1-methylimidazol-2-yl)methylamino]ethyl]carbamate;hydrochloride (PubChem CID 115616317) has the molecular formula C10H19ClN4O2 and a molecular weight of 262.74 g/mol. Its IUPAC name is ethyl N-[2-[(1-methylimidazol-2-yl)methylamino]ethyl]carbamate;hydrochloride.
| Compound Name | ethyl N-[2-[(1-methylimidazol-2-yl)methylamino]ethyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 115616317 |
| Molecular Formula | C10H19ClN4O2 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | ethyl N-[2-[(1-methylimidazol-2-yl)methylamino]ethyl]carbamate;hydrochloride |
| SMILES | CCOC(=O)NCCNCc1nccn1C.Cl |
| InChI | InChI=1S/C10H18N4O2.ClH/c1-3-16-10(15)13-5-4-11-8-9-12-6-7-14(9)2;/h6-7,11H,3-5,8H2,1-2H3,(H,13,15);1H |
| InChIKey | WCHNDVJZPRJFLZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|