C9H14N6 — CID 115682458
N-[(3-methyltriazol-4-yl)methyl]-2-pyrazol-1-ylethanamine (PubChem CID 115682458) has the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. Its IUPAC name is N-[(3-methyltriazol-4-yl)methyl]-2-pyrazol-1-ylethanamine.
| Compound Name | N-[(3-methyltriazol-4-yl)methyl]-2-pyrazol-1-ylethanamine |
|---|---|
| PubChem CID | 115682458 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | N-[(3-methyltriazol-4-yl)methyl]-2-pyrazol-1-ylethanamine |
| SMILES | Cn1nncc1CNCCn1cccn1 |
| InChI | InChI=1S/C9H14N6/c1-14-9(8-11-13-14)7-10-4-6-15-5-2-3-12-15/h2-3,5,8,10H,4,6-7H2,1H3 |
| InChIKey | CIHWEWYNBBAWAJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|