C9H18N4O — CID 115703082
1-[(3-methyltriazol-4-yl)methylamino]pentan-3-ol (PubChem CID 115703082) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-[(3-methyltriazol-4-yl)methylamino]pentan-3-ol.
| Compound Name | 1-[(3-methyltriazol-4-yl)methylamino]pentan-3-ol |
|---|---|
| PubChem CID | 115703082 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 1-[(3-methyltriazol-4-yl)methylamino]pentan-3-ol |
| SMILES | CCC(O)CCNCc1cnnn1C |
| InChI | InChI=1S/C9H18N4O/c1-3-9(14)4-5-10-6-8-7-11-12-13(8)2/h7,9-10,14H,3-6H2,1-2H3 |
| InChIKey | ADDCNFPJLMBKLT-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|