C10H15N5 — CID 62350133
N-[(1-methylimidazol-2-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine (PubChem CID 62350133) has the molecular formula C10H15N5 and a molecular weight of 205.27 g/mol. Its IUPAC name is N-[(1-methylimidazol-2-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine.
| Compound Name | N-[(1-methylimidazol-2-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 62350133 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-[(1-methylimidazol-2-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine |
| SMILES | Cc1[nH]ncc1CNCc1nccn1C |
| InChI | InChI=1S/C10H15N5/c1-8-9(6-13-14-8)5-11-7-10-12-3-4-15(10)2/h3-4,6,11H,5,7H2,1-2H3,(H,13,14) |
| InChIKey | SPGOFGGBPJKAMK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |