C13H18N4O2 — CID 116686398
5-(hydroxymethyl)-2-methyl-4-[[(1-methylimidazol-2-yl)methylamino]methyl]pyridin-3-ol (PubChem CID 116686398) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-4-[[(1-methylimidazol-2-yl)methylamino]methyl]pyridin-3-ol.
| Compound Name | 5-(hydroxymethyl)-2-methyl-4-[[(1-methylimidazol-2-yl)methylamino]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 116686398 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-4-[[(1-methylimidazol-2-yl)methylamino]methyl]pyridin-3-ol |
| SMILES | Cc1ncc(CO)c(CNCc2nccn2C)c1O |
| InChI | InChI=1S/C13H18N4O2/c1-9-13(19)11(10(8-18)5-16-9)6-14-7-12-15-3-4-17(12)2/h3-5,14,18-19H,6-8H2,1-2H3 |
| InChIKey | KPEVIUWGLKTLQF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |