C9H13N5 — CID 62133116
1-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]imidazol-2-amine (PubChem CID 62133116) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 1-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]imidazol-2-amine.
| Compound Name | 1-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 62133116 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 1-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]imidazol-2-amine |
| SMILES | Cc1[nH]ncc1CNc1nccn1C |
| InChI | InChI=1S/C9H13N5/c1-7-8(6-12-13-7)5-11-9-10-3-4-14(9)2/h3-4,6H,5H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | SFMOSKSIXVMAGV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |