C12H16N3- — CID 91928165
1-cyclopenta-1,4-dien-1-yl-N-[(1-ethylimidazol-2-yl)methyl]methanamine (PubChem CID 91928165) has the molecular formula C12H16N3- and a molecular weight of 202.28 g/mol. Its IUPAC name is 1-cyclopenta-1,4-dien-1-yl-N-[(1-ethylimidazol-2-yl)methyl]methanamine.
| Compound Name | 1-cyclopenta-1,4-dien-1-yl-N-[(1-ethylimidazol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 91928165 |
| Molecular Formula | C12H16N3- |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 1-cyclopenta-1,4-dien-1-yl-N-[(1-ethylimidazol-2-yl)methyl]methanamine |
| SMILES | CCn1ccnc1CNCc1cc[cH-]c1 |
| InChI | InChI=1S/C12H16N3/c1-2-15-8-7-14-12(15)10-13-9-11-5-3-4-6-11/h3-8,13H,2,9-10H2,1H3/q-1 |
| InChIKey | GJCOWTNYBURFKK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|