C11H15N5 — CID 106834150
N-[(1-ethylimidazol-2-yl)methyl]-1-pyridazin-3-ylmethanamine (PubChem CID 106834150) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is N-[(1-ethylimidazol-2-yl)methyl]-1-pyridazin-3-ylmethanamine.
| Compound Name | N-[(1-ethylimidazol-2-yl)methyl]-1-pyridazin-3-ylmethanamine |
|---|---|
| PubChem CID | 106834150 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | N-[(1-ethylimidazol-2-yl)methyl]-1-pyridazin-3-ylmethanamine |
| SMILES | CCn1ccnc1CNCc1cccnn1 |
| InChI | InChI=1S/C11H15N5/c1-2-16-7-6-13-11(16)9-12-8-10-4-3-5-14-15-10/h3-7,12H,2,8-9H2,1H3 |
| InChIKey | UGUODRHQCWDSHO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |