C15H17BrN2S — CID 80577286
N-[(5-bromothiophen-2-yl)methyl]-2-(2,3-dihydro-1H-indol-3-yl)ethanamine (PubChem CID 80577286) has the molecular formula C15H17BrN2S and a molecular weight of 337.29 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-(2,3-dihydro-1H-indol-3-yl)ethanamine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-(2,3-dihydro-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 80577286 |
| Molecular Formula | C15H17BrN2S |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-(2,3-dihydro-1H-indol-3-yl)ethanamine |
| SMILES | Brc1ccc(CNCCC2CNc3ccccc32)s1 |
| InChI | InChI=1S/C15H17BrN2S/c16-15-6-5-12(19-15)10-17-8-7-11-9-18-14-4-2-1-3-13(11)14/h1-6,11,17-18H,7-10H2 |
| InChIKey | LRUDRZFESOUNRM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|