C17H17FN2O — CID 24700732
N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2-fluorobenzamide (PubChem CID 24700732) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 24700732 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2-fluorobenzamide |
| SMILES | O=C(NCCC1CNc2ccccc21)c1ccccc1F |
| InChI | InChI=1S/C17H17FN2O/c18-15-7-3-1-6-14(15)17(21)19-10-9-12-11-20-16-8-4-2-5-13(12)16/h1-8,12,20H,9-11H2,(H,19,21) |
| InChIKey | GZFWEFKMGNDXSE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |