C20H21N3O3 — CID 20579488
N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide (PubChem CID 20579488) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 20579488 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)NCCC2CNc3ccccc32)cc1)NO |
| InChI | InChI=1S/C20H21N3O3/c24-19(23-26)10-7-14-5-8-15(9-6-14)20(25)21-12-11-16-13-22-18-4-2-1-3-17(16)18/h1-10,16,22,26H,11-13H2,(H,21,25)(H,23,24)/b10-7+ |
| InChIKey | FCBNLDVEMDZTDD-JXMROGBWSA-N |
| XLogP | 2.53 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|