C19H22N2O — CID 24709751
N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide (PubChem CID 24709751) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide.
| Compound Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 24709751 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)NCCC2CNc3ccccc32)c1C |
| InChI | InChI=1S/C19H22N2O/c1-13-6-5-8-16(14(13)2)19(22)20-11-10-15-12-21-18-9-4-3-7-17(15)18/h3-9,15,21H,10-12H2,1-2H3,(H,20,22) |
| InChIKey | ITYFIKOVGYZLGL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |