About N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide
N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide (PubChem CID 24709751) has the molecular formula C19H22N2O
and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide |
| PubChem CID | 24709751 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)NCCC2CNc3ccccc32)c1C |
| InChI | InChI=1S/C19H22N2O/c1-13-6-5-8-16(14(13)2)19(22)20-11-10-15-12-21-18-9-4-3-7-17(15)18/h3-9,15,21H,10-12H2,1-2H3,(H,20,22) |
| InChIKey | ITYFIKOVGYZLGL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide?
The IUPAC name of N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide (CID 24709751) is N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide.
What is the SMILES notation for N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide?
The canonical SMILES for N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide is Cc1cccc(C(=O)NCCC2CNc3ccccc32)c1C.
What is the InChIKey of N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide?
The InChIKey is ITYFIKOVGYZLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O/c1-13-6-5-8-16(14(13)2)19(22)20-11-10-15-12-21-18-9-4-3-7-17(15)18/h3-9,15,21H,10-12H2,1-2H3,(H,20,22).
What are the key properties of N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide?
N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide has a molecular weight of 294.40 g/mol, XLogP of 3.63, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2,3-dimethylbenzamide is sourced from PubChem (CID 24709751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).