C20H22N2O4 — CID 142653052
[2-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethylcarbamoyl]phenyl] acetate (PubChem CID 142653052) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is [2-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethylcarbamoyl]phenyl] acetate.
| Compound Name | [2-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 142653052 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [2-[2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)ethylcarbamoyl]phenyl] acetate |
| SMILES | COc1ccc2c(c1)C(CCNC(=O)c1ccccc1OC(C)=O)CN2 |
| InChI | InChI=1S/C20H22N2O4/c1-13(23)26-19-6-4-3-5-16(19)20(24)21-10-9-14-12-22-18-8-7-15(25-2)11-17(14)18/h3-8,11,14,22H,9-10,12H2,1-2H3,(H,21,24) |
| InChIKey | FKLFVDKQFJCZNJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|