C13H17ClN2O2 — CID 11737271
N-[2-(6-chloro-5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]acetamide (PubChem CID 11737271) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is N-[2-(6-chloro-5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | N-[2-(6-chloro-5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 11737271 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-[2-(6-chloro-5-methoxy-2,3-dihydro-1H-indol-3-yl)ethyl]acetamide |
| SMILES | COc1cc2c(cc1Cl)NCC2CCNC(C)=O |
| InChI | InChI=1S/C13H17ClN2O2/c1-8(17)15-4-3-9-7-16-12-6-11(14)13(18-2)5-10(9)12/h5-6,9,16H,3-4,7H2,1-2H3,(H,15,17) |
| InChIKey | SVVAZPMMGMYUJF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|