About N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine
N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine (PubChem CID 114807450) has the molecular formula C13H21N3O2S
and a molecular weight of 283.40 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine |
| PubChem CID | 114807450 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine |
| SMILES | CC(C)NS(=O)(=O)NCCC1CNc2ccccc21 |
| InChI | InChI=1S/C13H21N3O2S/c1-10(2)16-19(17,18)15-8-7-11-9-14-13-6-4-3-5-12(11)13/h3-6,10-11,14-16H,7-9H2,1-2H3 |
| InChIKey | SNTIEFZKCAHMEM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine?
The IUPAC name of N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine (CID 114807450) is N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine.
What is the SMILES notation for N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine?
The canonical SMILES for N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine is CC(C)NS(=O)(=O)NCCC1CNc2ccccc21.
What is the InChIKey of N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine?
The InChIKey is SNTIEFZKCAHMEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2S/c1-10(2)16-19(17,18)15-8-7-11-9-14-13-6-4-3-5-12(11)13/h3-6,10-11,14-16H,7-9H2,1-2H3.
What are the key properties of N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine?
N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine has a molecular weight of 283.40 g/mol, XLogP of 1.42, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,3-dihydro-1H-indol-3-yl)ethylsulfamoyl]propan-2-amine is sourced from PubChem (CID 114807450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).