C14H22N2O3S — CID 63245562
N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2-ethoxyethanesulfonamide (PubChem CID 63245562) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2-ethoxyethanesulfonamide.
| Compound Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2-ethoxyethanesulfonamide |
|---|---|
| PubChem CID | 63245562 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]-2-ethoxyethanesulfonamide |
| SMILES | CCOCCS(=O)(=O)NCCC1CNc2ccccc21 |
| InChI | InChI=1S/C14H22N2O3S/c1-2-19-9-10-20(17,18)16-8-7-12-11-15-14-6-4-3-5-13(12)14/h3-6,12,15-16H,2,7-11H2,1H3 |
| InChIKey | OCYBFTFDTCWRLM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|