C19H25N — CID 142629734
1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine (PubChem CID 142629734) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine.
| Compound Name | 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 142629734 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine |
| SMILES | CCCCCCC1CCn2ccc(-c3ccccc3)c21 |
| InChI | InChI=1S/C19H25N/c1-2-3-4-6-11-17-12-14-20-15-13-18(19(17)20)16-9-7-5-8-10-16/h5,7-10,13,15,17H,2-4,6,11-12,14H2,1H3 |
| InChIKey | QQVQTOZQABNXNJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|