About 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine
1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine (PubChem CID 142629734) has the molecular formula C19H25N
and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine.
Molecular Properties
| Compound Name | 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine |
| PubChem CID | 142629734 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine |
| SMILES | CCCCCCC1CCn2ccc(-c3ccccc3)c21 |
| InChI | InChI=1S/C19H25N/c1-2-3-4-6-11-17-12-14-20-15-13-18(19(17)20)16-9-7-5-8-10-16/h5,7-10,13,15,17H,2-4,6,11-12,14H2,1H3 |
| InChIKey | QQVQTOZQABNXNJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine?
The IUPAC name of 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine (CID 142629734) is 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine.
What is the SMILES notation for 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine?
The canonical SMILES for 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine is CCCCCCC1CCn2ccc(-c3ccccc3)c21.
What is the InChIKey of 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine?
The InChIKey is QQVQTOZQABNXNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N/c1-2-3-4-6-11-17-12-14-20-15-13-18(19(17)20)16-9-7-5-8-10-16/h5,7-10,13,15,17H,2-4,6,11-12,14H2,1H3.
What are the key properties of 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine?
1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine has a molecular weight of 267.42 g/mol, XLogP of 5.61, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-7-phenyl-2,3-dihydro-1H-pyrrolizine is sourced from PubChem (CID 142629734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).