About 1,1'-biphenyl;2-pentylcyclohexan-1-one
1,1'-biphenyl;2-pentylcyclohexan-1-one (PubChem CID 174847446) has the molecular formula C23H30O
and a molecular weight of 322.49 g/mol. Its IUPAC name is 1,1'-biphenyl;2-pentylcyclohexan-1-one.
Molecular Properties
| Compound Name | 1,1'-biphenyl;2-pentylcyclohexan-1-one |
| PubChem CID | 174847446 |
| Molecular Formula | C23H30O |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1,1'-biphenyl;2-pentylcyclohexan-1-one |
| SMILES | CCCCCC1CCCCC1=O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C11H20O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-4-7-10-8-5-6-9-11(10)12/h1-10H;10H,2-9H2,1H3 |
| InChIKey | FOMXEKFUAVAJFV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;2-pentylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;2-pentylcyclohexan-1-one?
The IUPAC name of 1,1'-biphenyl;2-pentylcyclohexan-1-one (CID 174847446) is 1,1'-biphenyl;2-pentylcyclohexan-1-one.
What is the SMILES notation for 1,1'-biphenyl;2-pentylcyclohexan-1-one?
The canonical SMILES for 1,1'-biphenyl;2-pentylcyclohexan-1-one is CCCCCC1CCCCC1=O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;2-pentylcyclohexan-1-one?
The InChIKey is FOMXEKFUAVAJFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C11H20O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-4-7-10-8-5-6-9-11(10)12/h1-10H;10H,2-9H2,1H3.
What are the key properties of 1,1'-biphenyl;2-pentylcyclohexan-1-one?
1,1'-biphenyl;2-pentylcyclohexan-1-one has a molecular weight of 322.49 g/mol, XLogP of 6.68, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;2-pentylcyclohexan-1-one is sourced from PubChem (CID 174847446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).