C12H25NO — CID 145289923
2-butylcyclopentan-1-one;N,N-dimethylmethanamine (PubChem CID 145289923) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 2-butylcyclopentan-1-one;N,N-dimethylmethanamine.
| Compound Name | 2-butylcyclopentan-1-one;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 145289923 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 2-butylcyclopentan-1-one;N,N-dimethylmethanamine |
| SMILES | CCCCC1CCCC1=O.CN(C)C |
| InChI | InChI=1S/C9H16O.C3H9N/c1-2-3-5-8-6-4-7-9(8)10;1-4(2)3/h8H,2-7H2,1H3;1-3H3 |
| InChIKey | REUQCHYIMZELFT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |