About formic acid;2-pentylcyclohexan-1-one
formic acid;2-pentylcyclohexan-1-one (PubChem CID 174877274) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is formic acid;2-pentylcyclohexan-1-one.
Molecular Properties
| Compound Name | formic acid;2-pentylcyclohexan-1-one |
| PubChem CID | 174877274 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | formic acid;2-pentylcyclohexan-1-one |
| SMILES | CCCCCC1CCCCC1=O.O=CO |
| InChI | InChI=1S/C11H20O.CH2O2/c1-2-3-4-7-10-8-5-6-9-11(10)12;2-1-3/h10H,2-9H2,1H3;1H,(H,2,3) |
| InChIKey | VAJMBAOTLCEAPC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formic acid;2-pentylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;2-pentylcyclohexan-1-one?
The IUPAC name of formic acid;2-pentylcyclohexan-1-one (CID 174877274) is formic acid;2-pentylcyclohexan-1-one.
What is the SMILES notation for formic acid;2-pentylcyclohexan-1-one?
The canonical SMILES for formic acid;2-pentylcyclohexan-1-one is CCCCCC1CCCCC1=O.O=CO.
What is the InChIKey of formic acid;2-pentylcyclohexan-1-one?
The InChIKey is VAJMBAOTLCEAPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O.CH2O2/c1-2-3-4-7-10-8-5-6-9-11(10)12;2-1-3/h10H,2-9H2,1H3;1H,(H,2,3).
What are the key properties of formic acid;2-pentylcyclohexan-1-one?
formic acid;2-pentylcyclohexan-1-one has a molecular weight of 214.30 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;2-pentylcyclohexan-1-one is sourced from PubChem (CID 174877274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).