C16H25N — CID 102127006
(1R,4R)-1-hexyl-4-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 102127006) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (1R,4R)-1-hexyl-4-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R,4R)-1-hexyl-4-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 102127006 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (1R,4R)-1-hexyl-4-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCCCCC[C@H]1NC[C@H](C)c2ccccc21 |
| InChI | InChI=1S/C16H25N/c1-3-4-5-6-11-16-15-10-8-7-9-14(15)13(2)12-17-16/h7-10,13,16-17H,3-6,11-12H2,1-2H3/t13-,16+/m0/s1 |
| InChIKey | PJLBFIVOLBNZAD-XJKSGUPXSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|