C15H24N2 — CID 70424924
(4-pentyl-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine (PubChem CID 70424924) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is (4-pentyl-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine.
| Compound Name | (4-pentyl-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine |
|---|---|
| PubChem CID | 70424924 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (4-pentyl-1,2,3,4-tetrahydroisoquinolin-1-yl)methanamine |
| SMILES | CCCCCC1CNC(CN)c2ccccc21 |
| InChI | InChI=1S/C15H24N2/c1-2-3-4-7-12-11-17-15(10-16)14-9-6-5-8-13(12)14/h5-6,8-9,12,15,17H,2-4,7,10-11,16H2,1H3 |
| InChIKey | BASQXWQXUQEZCS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|