C19H31NO2 — CID 98157851
(1S)-1-decyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 98157851) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is (1S)-1-decyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | (1S)-1-decyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 98157851 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (1S)-1-decyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | CCCCCCCCCC[C@@H]1NCCc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C19H31NO2/c1-2-3-4-5-6-7-8-9-10-17-16-14-19(22)18(21)13-15(16)11-12-20-17/h13-14,17,20-22H,2-12H2,1H3/t17-/m0/s1 |
| InChIKey | XTGQKELRAHOJLG-KRWDZBQOSA-N |
| XLogP | 4.82 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|