C20H33NO2 — CID 98157796
(1S)-1-[(2R)-undecan-2-yl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 98157796) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (1S)-1-[(2R)-undecan-2-yl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | (1S)-1-[(2R)-undecan-2-yl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 98157796 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (1S)-1-[(2R)-undecan-2-yl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | CCCCCCCCC[C@@H](C)[C@@H]1NCCc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C20H33NO2/c1-3-4-5-6-7-8-9-10-15(2)20-17-14-19(23)18(22)13-16(17)11-12-21-20/h13-15,20-23H,3-12H2,1-2H3/t15-,20+/m1/s1 |
| InChIKey | VLQPLJSKLFZZKM-QRWLVFNGSA-N |
| XLogP | 5.06 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|