C16H17Br2NO4 — CID 171370606
1-[(2-bromo-4,5-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide (PubChem CID 171370606) has the molecular formula C16H17Br2NO4 and a molecular weight of 447.12 g/mol. Its IUPAC name is 1-[(2-bromo-4,5-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide.
| Compound Name | 1-[(2-bromo-4,5-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide |
|---|---|
| PubChem CID | 171370606 |
| Molecular Formula | C16H17Br2NO4 |
| Molecular Weight | 447.12 g/mol |
| Exact Mass | 444.95 |
| IUPAC Name | 1-[(2-bromo-4,5-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide |
| SMILES | Br.Oc1cc(Br)c(CC2NCCc3cc(O)c(O)cc32)cc1O |
| InChI | InChI=1S/C16H16BrNO4.BrH/c17-11-7-16(22)14(20)5-9(11)3-12-10-6-15(21)13(19)4-8(10)1-2-18-12;/h4-7,12,18-22H,1-3H2;1H |
| InChIKey | MEOYDTCHLAQEAR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.12 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|