C19H24ClNO5 — CID 50986941
hydron;1-[(2,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;chloride (PubChem CID 50986941) has the molecular formula C19H24ClNO5 and a molecular weight of 381.86 g/mol. Its IUPAC name is hydron;1-[(2,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;chloride.
| Compound Name | hydron;1-[(2,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;chloride |
|---|---|
| PubChem CID | 50986941 |
| Molecular Formula | C19H24ClNO5 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | hydron;1-[(2,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;chloride |
| SMILES | COc1cc(OC)c(OC)cc1CC1NCCc2cc(O)c(O)cc21.[Cl-].[H+] |
| InChI | InChI=1S/C19H23NO5.ClH/c1-23-17-10-19(25-3)18(24-2)8-12(17)6-14-13-9-16(22)15(21)7-11(13)4-5-20-14;/h7-10,14,20-22H,4-6H2,1-3H3;1H |
| InChIKey | RAWZMAIHHVRUHU-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|