C18H19I2NO3 — CID 10167302
(1S)-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol (PubChem CID 10167302) has the molecular formula C18H19I2NO3 and a molecular weight of 551.16 g/mol. Its IUPAC name is (1S)-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol.
| Compound Name | (1S)-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol |
|---|---|
| PubChem CID | 10167302 |
| Molecular Formula | C18H19I2NO3 |
| Molecular Weight | 551.16 g/mol |
| Exact Mass | 550.95 |
| IUPAC Name | (1S)-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol |
| SMILES | COc1cc2c(cc1O)[C@H](Cc1cc(I)c(OC)c(I)c1)NCC2 |
| InChI | InChI=1S/C18H19I2NO3/c1-23-17-8-11-3-4-21-15(12(11)9-16(17)22)7-10-5-13(19)18(24-2)14(20)6-10/h5-6,8-9,15,21-22H,3-4,7H2,1-2H3/t15-/m0/s1 |
| InChIKey | YQTLQHSVDWXGTE-HNNXBMFYSA-N |
| XLogP | 4.05 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|