C17H18ClI2NO3 — CID 10166900
(1R)-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride (PubChem CID 10166900) has the molecular formula C17H18ClI2NO3 and a molecular weight of 573.60 g/mol. Its IUPAC name is (1R)-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride.
| Compound Name | (1R)-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride |
|---|---|
| PubChem CID | 10166900 |
| Molecular Formula | C17H18ClI2NO3 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 572.91 |
| IUPAC Name | (1R)-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride |
| SMILES | COc1c(I)cc(C[C@H]2NCCc3cc(O)c(O)cc32)cc1I.Cl |
| InChI | InChI=1S/C17H17I2NO3.ClH/c1-23-17-12(18)4-9(5-13(17)19)6-14-11-8-16(22)15(21)7-10(11)2-3-20-14;/h4-5,7-8,14,20-22H,2-3,6H2,1H3;1H/t14-;/m1./s1 |
| InChIKey | VKQAZCXTLGMRLB-PFEQFJNWSA-N |
| XLogP | 4.17 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|