C17H18I2N2O2 — CID 10168104
(1R)-7-amino-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-6-ol (PubChem CID 10168104) has the molecular formula C17H18I2N2O2 and a molecular weight of 536.15 g/mol. Its IUPAC name is (1R)-7-amino-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-6-ol.
| Compound Name | (1R)-7-amino-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-6-ol |
|---|---|
| PubChem CID | 10168104 |
| Molecular Formula | C17H18I2N2O2 |
| Molecular Weight | 536.15 g/mol |
| Exact Mass | 535.95 |
| IUPAC Name | (1R)-7-amino-1-[(3,5-diiodo-4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-6-ol |
| SMILES | COc1c(I)cc(C[C@H]2NCCc3cc(O)c(N)cc32)cc1I |
| InChI | InChI=1S/C17H18I2N2O2/c1-23-17-12(18)4-9(5-13(17)19)6-15-11-8-14(20)16(22)7-10(11)2-3-21-15/h4-5,7-8,15,21-22H,2-3,6,20H2,1H3/t15-/m1/s1 |
| InChIKey | QMEWTRXBIQXJLQ-OAHLLOKOSA-N |
| XLogP | 3.62 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.15 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|