C18H21NO2 — CID 7157325
(1R)-1-benzyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 7157325) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (1R)-1-benzyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R)-1-benzyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 7157325 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (1R)-1-benzyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)[C@@H](Cc1ccccc1)NCC2 |
| InChI | InChI=1S/C18H21NO2/c1-20-17-11-14-8-9-19-16(15(14)12-18(17)21-2)10-13-6-4-3-5-7-13/h3-7,11-12,16,19H,8-10H2,1-2H3/t16-/m1/s1 |
| InChIKey | HWNSTGWDEVWFNH-MRXNPFEDSA-N |
| XLogP | 3.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |