C26H27NO6 — CID 69307329
6,7-dimethoxy-1-[(4-phenylphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline;oxalic acid (PubChem CID 69307329) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is 6,7-dimethoxy-1-[(4-phenylphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline;oxalic acid.
| Compound Name | 6,7-dimethoxy-1-[(4-phenylphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline;oxalic acid |
|---|---|
| PubChem CID | 69307329 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 6,7-dimethoxy-1-[(4-phenylphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline;oxalic acid |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc(-c3ccccc3)cc1)NCC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H25NO2.C2H2O4/c1-26-23-15-20-12-13-25-22(21(20)16-24(23)27-2)14-17-8-10-19(11-9-17)18-6-4-3-5-7-18;3-1(4)2(5)6/h3-11,15-16,22,25H,12-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | XEMQZJXHCIHGQU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|