C25H32N2O5 — CID 54506652
1,3-bis(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)propan-2-one (PubChem CID 54506652) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1,3-bis(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)propan-2-one.
| Compound Name | 1,3-bis(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)propan-2-one |
|---|---|
| PubChem CID | 54506652 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 1,3-bis(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)propan-2-one |
| SMILES | COc1cc2c(cc1OC)C(CC(=O)CC1NCCc3cc(OC)c(OC)cc31)NCC2 |
| InChI | InChI=1S/C25H32N2O5/c1-29-22-9-15-5-7-26-20(18(15)13-24(22)31-3)11-17(28)12-21-19-14-25(32-4)23(30-2)10-16(19)6-8-27-21/h9-10,13-14,20-21,26-27H,5-8,11-12H2,1-4H3 |
| InChIKey | YGEMHBIYRQYKKU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |