C16H24N2O4 — CID 125482427
2-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-N-(3-hydroxypropyl)acetamide (PubChem CID 125482427) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-N-(3-hydroxypropyl)acetamide.
| Compound Name | 2-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 125482427 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-[(1S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-N-(3-hydroxypropyl)acetamide |
| SMILES | COc1cc2c(cc1OC)[C@H](CC(=O)NCCCO)NCC2 |
| InChI | InChI=1S/C16H24N2O4/c1-21-14-8-11-4-6-17-13(12(11)9-15(14)22-2)10-16(20)18-5-3-7-19/h8-9,13,17,19H,3-7,10H2,1-2H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | WAKHOVWVFWORQO-ZDUSSCGKSA-N |
| XLogP | 0.78 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|