C10H13NO3 — CID 67158558
1-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 67158558) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | 1-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 67158558 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | OCC1NCCc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C10H13NO3/c12-5-8-7-4-10(14)9(13)3-6(7)1-2-11-8/h3-4,8,11-14H,1-2,5H2 |
| InChIKey | RVWRJAOYAHTMLC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|