C16H18BrNO4 — CID 20511257
1-[(4-hydroxyphenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide (PubChem CID 20511257) has the molecular formula C16H18BrNO4 and a molecular weight of 368.23 g/mol. Its IUPAC name is 1-[(4-hydroxyphenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide.
| Compound Name | 1-[(4-hydroxyphenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide |
|---|---|
| PubChem CID | 20511257 |
| Molecular Formula | C16H18BrNO4 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 1-[(4-hydroxyphenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide |
| SMILES | Br.Oc1ccc(OCC2NCCc3cc(O)c(O)cc32)cc1 |
| InChI | InChI=1S/C16H17NO4.BrH/c18-11-1-3-12(4-2-11)21-9-14-13-8-16(20)15(19)7-10(13)5-6-17-14;/h1-4,7-8,14,17-20H,5-6,9H2;1H |
| InChIKey | UTOBVENMOWEIMR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|