C19H21NO3S — CID 12773864
1-[(4-prop-2-enoxyphenyl)sulfanylmethyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 12773864) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-[(4-prop-2-enoxyphenyl)sulfanylmethyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | 1-[(4-prop-2-enoxyphenyl)sulfanylmethyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 12773864 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-[(4-prop-2-enoxyphenyl)sulfanylmethyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | C=CCOc1ccc(SCC2NCCc3cc(O)c(O)cc32)cc1 |
| InChI | InChI=1S/C19H21NO3S/c1-2-9-23-14-3-5-15(6-4-14)24-12-17-16-11-19(22)18(21)10-13(16)7-8-20-17/h2-6,10-11,17,20-22H,1,7-9,12H2 |
| InChIKey | KJKOMWWJDYVQPG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|