C17H19NO2 — CID 96961625
(1S)-1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 96961625) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (1S)-1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | (1S)-1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 96961625 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (1S)-1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | Oc1cc2c(cc1O)[C@H](CCc1ccccc1)NCC2 |
| InChI | InChI=1S/C17H19NO2/c19-16-10-13-8-9-18-15(14(13)11-17(16)20)7-6-12-4-2-1-3-5-12/h1-5,10-11,15,18-20H,6-9H2/t15-/m0/s1 |
| InChIKey | RDKWHSLKQHZVFJ-HNNXBMFYSA-N |
| XLogP | 2.92 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|